C41H45ClN4O7 — CID 146776360
benzyl N-[(2R,5S)-9-[bis(phenylmethoxycarbonylamino)methylideneamino]-1-chloro-2-methyl-4-oxo-1-phenylnonan-5-yl]carbamate (PubChem CID 146776360) has the molecular formula C41H45ClN4O7 and a molecular weight of 741.29 g/mol. Its IUPAC name is benzyl N-[(2R,5S)-9-[bis(phenylmethoxycarbonylamino)methylideneamino]-1-chloro-2-methyl-4-oxo-1-phenylnonan-5-yl]carbamate.
| Compound Name | benzyl N-[(2R,5S)-9-[bis(phenylmethoxycarbonylamino)methylideneamino]-1-chloro-2-methyl-4-oxo-1-phenylnonan-5-yl]carbamate |
|---|---|
| PubChem CID | 146776360 |
| Molecular Formula | C41H45ClN4O7 |
| Molecular Weight | 741.29 g/mol |
| Exact Mass | 740.30 |
| IUPAC Name | benzyl N-[(2R,5S)-9-[bis(phenylmethoxycarbonylamino)methylideneamino]-1-chloro-2-methyl-4-oxo-1-phenylnonan-5-yl]carbamate |
| SMILES | C[C@H](CC(=O)[C@H](CCCCN=C(NC(=O)OCc1ccccc1)NC(=O)OCc1ccccc1)NC(=O)OCc1ccccc1)C(Cl)c1ccccc1 |
| InChI | InChI=1S/C41H45ClN4O7/c1-30(37(42)34-22-12-5-13-23-34)26-36(47)35(44-39(48)51-27-31-16-6-2-7-17-31)24-14-15-25-43-38(45-40(49)52-28-32-18-8-3-9-19-32)46-41(50)53-29-33-20-10-4-11-21-33/h2-13,16-23,30,35,37H,14-15,24-29H2,1H3,(H,44,48)(H2,43,45,46,49,50)/t30-,35+,37?/m1/s1 |
| InChIKey | RSUNNNIXUQANKS-MMUALWSYSA-N |
| XLogP | 8.24 |
| TPSA | 144.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.29 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|