C32H35ClN4O7 — CID 11700106
benzyl N-[N'-[(4S)-6-chloro-4-[3-(4-hydroxyphenyl)propanoylamino]-5-oxohexyl]-N-phenylmethoxycarbonylcarbamimidoyl]carbamate (PubChem CID 11700106) has the molecular formula C32H35ClN4O7 and a molecular weight of 623.11 g/mol. Its IUPAC name is benzyl N-[N'-[(4S)-6-chloro-4-[3-(4-hydroxyphenyl)propanoylamino]-5-oxohexyl]-N-phenylmethoxycarbonylcarbamimidoyl]carbamate.
| Compound Name | benzyl N-[N'-[(4S)-6-chloro-4-[3-(4-hydroxyphenyl)propanoylamino]-5-oxohexyl]-N-phenylmethoxycarbonylcarbamimidoyl]carbamate |
|---|---|
| PubChem CID | 11700106 |
| Molecular Formula | C32H35ClN4O7 |
| Molecular Weight | 623.11 g/mol |
| Exact Mass | 622.22 |
| IUPAC Name | benzyl N-[N'-[(4S)-6-chloro-4-[3-(4-hydroxyphenyl)propanoylamino]-5-oxohexyl]-N-phenylmethoxycarbonylcarbamimidoyl]carbamate |
| SMILES | O=C(CCc1ccc(O)cc1)N[C@@H](CCCN=C(NC(=O)OCc1ccccc1)NC(=O)OCc1ccccc1)C(=O)CCl |
| InChI | InChI=1S/C32H35ClN4O7/c33-20-28(39)27(35-29(40)18-15-23-13-16-26(38)17-14-23)12-7-19-34-30(36-31(41)43-21-24-8-3-1-4-9-24)37-32(42)44-22-25-10-5-2-6-11-25/h1-6,8-11,13-14,16-17,27,38H,7,12,15,18-22H2,(H,35,40)(H2,34,36,37,41,42)/t27-/m0/s1 |
| InChIKey | SRTLKHMLMSMBHW-MHZLTWQESA-N |
| XLogP | 4.61 |
| TPSA | 155.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.11 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|