C19H20ClNO3 — CID 114929890
benzyl N-(1-chloro-2-oxo-5-phenylpentan-3-yl)carbamate (PubChem CID 114929890) has the molecular formula C19H20ClNO3 and a molecular weight of 345.83 g/mol. Its IUPAC name is benzyl N-(1-chloro-2-oxo-5-phenylpentan-3-yl)carbamate.
| Compound Name | benzyl N-(1-chloro-2-oxo-5-phenylpentan-3-yl)carbamate |
|---|---|
| PubChem CID | 114929890 |
| Molecular Formula | C19H20ClNO3 |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | benzyl N-(1-chloro-2-oxo-5-phenylpentan-3-yl)carbamate |
| SMILES | O=C(NC(CCc1ccccc1)C(=O)CCl)OCc1ccccc1 |
| InChI | InChI=1S/C19H20ClNO3/c20-13-18(22)17(12-11-15-7-3-1-4-8-15)21-19(23)24-14-16-9-5-2-6-10-16/h1-10,17H,11-14H2,(H,21,23) |
| InChIKey | CEIBNHZLYNBSJG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|