C20H25ClN2O7 — CID 159422022
5-chloro-3-[[2-methyl-4-oxo-5-(phenylmethoxycarbonylamino)hexanoyl]amino]-4-oxopentanoic acid (PubChem CID 159422022) has the molecular formula C20H25ClN2O7 and a molecular weight of 440.88 g/mol. Its IUPAC name is 5-chloro-3-[[2-methyl-4-oxo-5-(phenylmethoxycarbonylamino)hexanoyl]amino]-4-oxopentanoic acid.
| Compound Name | 5-chloro-3-[[2-methyl-4-oxo-5-(phenylmethoxycarbonylamino)hexanoyl]amino]-4-oxopentanoic acid |
|---|---|
| PubChem CID | 159422022 |
| Molecular Formula | C20H25ClN2O7 |
| Molecular Weight | 440.88 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 5-chloro-3-[[2-methyl-4-oxo-5-(phenylmethoxycarbonylamino)hexanoyl]amino]-4-oxopentanoic acid |
| SMILES | CC(CC(=O)C(C)NC(=O)OCc1ccccc1)C(=O)NC(CC(=O)O)C(=O)CCl |
| InChI | InChI=1S/C20H25ClN2O7/c1-12(19(28)23-15(9-18(26)27)17(25)10-21)8-16(24)13(2)22-20(29)30-11-14-6-4-3-5-7-14/h3-7,12-13,15H,8-11H2,1-2H3,(H,22,29)(H,23,28)(H,26,27) |
| InChIKey | LPWOTSPZJDCNRS-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 138.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.88 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|