C67H111N5O10 — CID 178056654
[8-[[(2S)-4-[bis(phenylmethoxycarbonylamino)methylideneamino]-1-[6-(2-hexyldecanoyloxy)hexylamino]-1-oxobutan-2-yl]amino]-8-oxooctyl] 2-hexyldecanoate (PubChem CID 178056654) has the molecular formula C67H111N5O10 and a molecular weight of 1146.65 g/mol. Its IUPAC name is [8-[[(2S)-4-[bis(phenylmethoxycarbonylamino)methylideneamino]-1-[6-(2-hexyldecanoyloxy)hexylamino]-1-oxobutan-2-yl]amino]-8-oxooctyl] 2-hexyldecanoate.
| Compound Name | [8-[[(2S)-4-[bis(phenylmethoxycarbonylamino)methylideneamino]-1-[6-(2-hexyldecanoyloxy)hexylamino]-1-oxobutan-2-yl]amino]-8-oxooctyl] 2-hexyldecanoate |
|---|---|
| PubChem CID | 178056654 |
| Molecular Formula | C67H111N5O10 |
| Molecular Weight | 1146.65 g/mol |
| Exact Mass | 1145.83 |
| IUPAC Name | [8-[[(2S)-4-[bis(phenylmethoxycarbonylamino)methylideneamino]-1-[6-(2-hexyldecanoyloxy)hexylamino]-1-oxobutan-2-yl]amino]-8-oxooctyl] 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCCCCCCC(=O)N[C@@H](CCN=C(NC(=O)OCc1ccccc1)NC(=O)OCc1ccccc1)C(=O)NCCCCCCOC(=O)C(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C67H111N5O10/c1-5-9-13-17-20-34-46-58(44-32-15-11-7-3)63(75)79-52-38-24-19-22-36-48-61(73)70-60(62(74)68-50-37-23-25-39-53-80-64(76)59(45-33-16-12-8-4)47-35-21-18-14-10-6-2)49-51-69-65(71-66(77)81-54-56-40-28-26-29-41-56)72-67(78)82-55-57-42-30-27-31-43-57/h26-31,40-43,58-60H,5-25,32-39,44-55H2,1-4H3,(H,68,74)(H,70,73)(H2,69,71,72,77,78)/t58?,59?,60-/m0/s1 |
| InChIKey | NARFYMPONSKBLU-AYMZASOTSA-N |
| XLogP | 15.85 |
| TPSA | 199.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 82 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1146.65 |
| LogP ≤ 5 | 15.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|