C41H79N5O6 — CID 178056332
[6-[[4-(diaminomethylideneamino)-1-oxo-1-[8-(2-propylheptanoyloxy)octylamino]butan-2-yl]amino]-6-oxohexyl] 2-butyloctanoate (PubChem CID 178056332) has the molecular formula C41H79N5O6 and a molecular weight of 738.11 g/mol. Its IUPAC name is [6-[[4-(diaminomethylideneamino)-1-oxo-1-[8-(2-propylheptanoyloxy)octylamino]butan-2-yl]amino]-6-oxohexyl] 2-butyloctanoate.
| Compound Name | [6-[[4-(diaminomethylideneamino)-1-oxo-1-[8-(2-propylheptanoyloxy)octylamino]butan-2-yl]amino]-6-oxohexyl] 2-butyloctanoate |
|---|---|
| PubChem CID | 178056332 |
| Molecular Formula | C41H79N5O6 |
| Molecular Weight | 738.11 g/mol |
| Exact Mass | 737.60 |
| IUPAC Name | [6-[[4-(diaminomethylideneamino)-1-oxo-1-[8-(2-propylheptanoyloxy)octylamino]butan-2-yl]amino]-6-oxohexyl] 2-butyloctanoate |
| SMILES | CCCCCCC(CCCC)C(=O)OCCCCCC(=O)NC(CCN=C(N)N)C(=O)NCCCCCCCCOC(=O)C(CCC)CCCCC |
| InChI | InChI=1S/C41H79N5O6/c1-5-9-12-19-27-35(25-11-7-3)40(50)52-33-23-17-20-28-37(47)46-36(29-31-45-41(42)43)38(48)44-30-21-15-13-14-16-22-32-51-39(49)34(24-8-4)26-18-10-6-2/h34-36H,5-33H2,1-4H3,(H,44,48)(H,46,47)(H4,42,43,45) |
| InChIKey | PKDWBGRWDBHCHG-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 175.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.11 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|