C37H71N5O6 — CID 178056342
[6-[[(2S)-4-(diaminomethylideneamino)-1-oxo-1-[4-(2-propylheptanoyloxy)butylamino]butan-2-yl]amino]-6-oxohexyl] 2-butyloctanoate (PubChem CID 178056342) has the molecular formula C37H71N5O6 and a molecular weight of 682.00 g/mol. Its IUPAC name is [6-[[(2S)-4-(diaminomethylideneamino)-1-oxo-1-[4-(2-propylheptanoyloxy)butylamino]butan-2-yl]amino]-6-oxohexyl] 2-butyloctanoate.
| Compound Name | [6-[[(2S)-4-(diaminomethylideneamino)-1-oxo-1-[4-(2-propylheptanoyloxy)butylamino]butan-2-yl]amino]-6-oxohexyl] 2-butyloctanoate |
|---|---|
| PubChem CID | 178056342 |
| Molecular Formula | C37H71N5O6 |
| Molecular Weight | 682.00 g/mol |
| Exact Mass | 681.54 |
| IUPAC Name | [6-[[(2S)-4-(diaminomethylideneamino)-1-oxo-1-[4-(2-propylheptanoyloxy)butylamino]butan-2-yl]amino]-6-oxohexyl] 2-butyloctanoate |
| SMILES | CCCCCCC(CCCC)C(=O)OCCCCCC(=O)N[C@@H](CCN=C(N)N)C(=O)NCCCCOC(=O)C(CCC)CCCCC |
| InChI | InChI=1S/C37H71N5O6/c1-5-9-12-15-23-31(21-11-7-3)36(46)47-28-18-13-16-24-33(43)42-32(25-27-41-37(38)39)34(44)40-26-17-19-29-48-35(45)30(20-8-4)22-14-10-6-2/h30-32H,5-29H2,1-4H3,(H,40,44)(H,42,43)(H4,38,39,41)/t30?,31?,32-/m0/s1 |
| InChIKey | AVLOHQZHKZDYJB-PDZHLSQESA-N |
| XLogP | 6.45 |
| TPSA | 175.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.00 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|