C26H48N4O7 — CID 178056225
4-[4-(diaminomethylideneamino)-2-(6-formyloxyhexanoylamino)butanoyl]oxybutyl 2-propylheptanoate (PubChem CID 178056225) has the molecular formula C26H48N4O7 and a molecular weight of 528.69 g/mol. Its IUPAC name is 4-[4-(diaminomethylideneamino)-2-(6-formyloxyhexanoylamino)butanoyl]oxybutyl 2-propylheptanoate.
| Compound Name | 4-[4-(diaminomethylideneamino)-2-(6-formyloxyhexanoylamino)butanoyl]oxybutyl 2-propylheptanoate |
|---|---|
| PubChem CID | 178056225 |
| Molecular Formula | C26H48N4O7 |
| Molecular Weight | 528.69 g/mol |
| Exact Mass | 528.35 |
| IUPAC Name | 4-[4-(diaminomethylideneamino)-2-(6-formyloxyhexanoylamino)butanoyl]oxybutyl 2-propylheptanoate |
| SMILES | CCCCCC(CCC)C(=O)OCCCCOC(=O)C(CCN=C(N)N)NC(=O)CCCCCOC=O |
| InChI | InChI=1S/C26H48N4O7/c1-3-5-7-13-21(12-4-2)24(33)36-18-10-11-19-37-25(34)22(15-16-29-26(27)28)30-23(32)14-8-6-9-17-35-20-31/h20-22H,3-19H2,1-2H3,(H,30,32)(H4,27,28,29) |
| InChIKey | RVFYELSJAMNKPI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 172.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.69 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|