C49H92N4O6 — CID 178056142
4-[2-[8-(1-cyclobutylidene-2-hexyldecoxy)octanoylamino]-4-(diaminomethylideneamino)butanoyl]oxybutyl 2-butyloctanoate (PubChem CID 178056142) has the molecular formula C49H92N4O6 and a molecular weight of 833.30 g/mol. Its IUPAC name is 4-[2-[8-(1-cyclobutylidene-2-hexyldecoxy)octanoylamino]-4-(diaminomethylideneamino)butanoyl]oxybutyl 2-butyloctanoate.
| Compound Name | 4-[2-[8-(1-cyclobutylidene-2-hexyldecoxy)octanoylamino]-4-(diaminomethylideneamino)butanoyl]oxybutyl 2-butyloctanoate |
|---|---|
| PubChem CID | 178056142 |
| Molecular Formula | C49H92N4O6 |
| Molecular Weight | 833.30 g/mol |
| Exact Mass | 832.70 |
| IUPAC Name | 4-[2-[8-(1-cyclobutylidene-2-hexyldecoxy)octanoylamino]-4-(diaminomethylideneamino)butanoyl]oxybutyl 2-butyloctanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(OCCCCCCCC(=O)NC(CCN=C(N)N)C(=O)OCCCCOC(=O)C(CCCC)CCCCCC)=C1CCC1 |
| InChI | InChI=1S/C49H92N4O6/c1-5-9-13-16-18-23-31-41(30-21-14-10-6-2)46(42-33-28-34-42)57-38-25-20-17-19-24-35-45(54)53-44(36-37-52-49(50)51)48(56)59-40-27-26-39-58-47(55)43(29-12-8-4)32-22-15-11-7-3/h41,43-44H,5-40H2,1-4H3,(H,53,54)(H4,50,51,52) |
| InChIKey | AFRWLLBMSIZJQG-UHFFFAOYSA-N |
| XLogP | 11.91 |
| TPSA | 155.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.30 |
| LogP ≤ 5 | 11.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|