C17H35N5O2 — CID 155426715
N-[1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]undecanamide (PubChem CID 155426715) has the molecular formula C17H35N5O2 and a molecular weight of 341.50 g/mol. Its IUPAC name is N-[1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]undecanamide.
| Compound Name | N-[1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]undecanamide |
|---|---|
| PubChem CID | 155426715 |
| Molecular Formula | C17H35N5O2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.28 |
| IUPAC Name | N-[1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]undecanamide |
| SMILES | CCCCCCCCCCC(=O)NC(CCCN=C(N)N)C(N)=O |
| InChI | InChI=1S/C17H35N5O2/c1-2-3-4-5-6-7-8-9-12-15(23)22-14(16(18)24)11-10-13-21-17(19)20/h14H,2-13H2,1H3,(H2,18,24)(H,22,23)(H4,19,20,21) |
| InChIKey | JGSQATHRZPODHV-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 136.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|