C35H67N5O6 — CID 178056334
[6-[[4-(diaminomethylideneamino)-1-oxo-1-[4-(2-propylheptanoyloxy)butylamino]butan-2-yl]amino]-6-oxohexyl] 2-propylheptanoate (PubChem CID 178056334) has the molecular formula C35H67N5O6 and a molecular weight of 653.95 g/mol. Its IUPAC name is [6-[[4-(diaminomethylideneamino)-1-oxo-1-[4-(2-propylheptanoyloxy)butylamino]butan-2-yl]amino]-6-oxohexyl] 2-propylheptanoate.
| Compound Name | [6-[[4-(diaminomethylideneamino)-1-oxo-1-[4-(2-propylheptanoyloxy)butylamino]butan-2-yl]amino]-6-oxohexyl] 2-propylheptanoate |
|---|---|
| PubChem CID | 178056334 |
| Molecular Formula | C35H67N5O6 |
| Molecular Weight | 653.95 g/mol |
| Exact Mass | 653.51 |
| IUPAC Name | [6-[[4-(diaminomethylideneamino)-1-oxo-1-[4-(2-propylheptanoyloxy)butylamino]butan-2-yl]amino]-6-oxohexyl] 2-propylheptanoate |
| SMILES | CCCCCC(CCC)C(=O)OCCCCCC(=O)NC(CCN=C(N)N)C(=O)NCCCCOC(=O)C(CCC)CCCCC |
| InChI | InChI=1S/C35H67N5O6/c1-5-9-12-20-28(18-7-3)33(43)45-26-16-11-14-22-31(41)40-30(23-25-39-35(36)37)32(42)38-24-15-17-27-46-34(44)29(19-8-4)21-13-10-6-2/h28-30H,5-27H2,1-4H3,(H,38,42)(H,40,41)(H4,36,37,39) |
| InChIKey | LCNSQYKJGKOMJO-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 175.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.95 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|