C43H81N3O8 — CID 178056670
6-[[(2S)-2-[4-(2-butyloctanoyloxy)butanoylamino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]hexyl 2-butyloctanoate (PubChem CID 178056670) has the molecular formula C43H81N3O8 and a molecular weight of 768.13 g/mol. Its IUPAC name is 6-[[(2S)-2-[4-(2-butyloctanoyloxy)butanoylamino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]hexyl 2-butyloctanoate.
| Compound Name | 6-[[(2S)-2-[4-(2-butyloctanoyloxy)butanoylamino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]hexyl 2-butyloctanoate |
|---|---|
| PubChem CID | 178056670 |
| Molecular Formula | C43H81N3O8 |
| Molecular Weight | 768.13 g/mol |
| Exact Mass | 767.60 |
| IUPAC Name | 6-[[(2S)-2-[4-(2-butyloctanoyloxy)butanoylamino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]hexyl 2-butyloctanoate |
| SMILES | CCCCCCC(CCCC)C(=O)OCCCCCCNC(=O)[C@H](CCNC(=O)OC(C)(C)C)NC(=O)CCCOC(=O)C(CCCC)CCCCCC |
| InChI | InChI=1S/C43H81N3O8/c1-8-12-16-20-27-35(25-14-10-3)40(49)52-33-23-19-18-22-31-44-39(48)37(30-32-45-42(51)54-43(5,6)7)46-38(47)29-24-34-53-41(50)36(26-15-11-4)28-21-17-13-9-2/h35-37H,8-34H2,1-7H3,(H,44,48)(H,45,51)(H,46,47)/t35?,36?,37-/m0/s1 |
| InChIKey | MCZAVAYDHWQUIW-FTKNPOSFSA-N |
| XLogP | 9.48 |
| TPSA | 149.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.13 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|