About tert-butyl N-(3-aminopropyl)carbamate;8-formyloxyoctyl 2-hexyldecanoate
tert-butyl N-(3-aminopropyl)carbamate;8-formyloxyoctyl 2-hexyldecanoate (PubChem CID 178056216) has the molecular formula C33H66N2O6
and a molecular weight of 586.90 g/mol. Its IUPAC name is tert-butyl N-(3-aminopropyl)carbamate;8-formyloxyoctyl 2-hexyldecanoate.
Molecular Properties
| Compound Name | tert-butyl N-(3-aminopropyl)carbamate;8-formyloxyoctyl 2-hexyldecanoate |
| PubChem CID | 178056216 |
| Molecular Formula | C33H66N2O6 |
| Molecular Weight | 586.90 g/mol |
| Exact Mass | 586.49 |
| IUPAC Name | tert-butyl N-(3-aminopropyl)carbamate;8-formyloxyoctyl 2-hexyldecanoate |
| SMILES | CC(C)(C)OC(=O)NCCCN.CCCCCCCCC(CCCCCC)C(=O)OCCCCCCCCOC=O |
| InChI | InChI=1S/C25H48O4.C8H18N2O2/c1-3-5-7-9-12-16-20-24(19-15-8-6-4-2)25(27)29-22-18-14-11-10-13-17-21-28-23-26;1-8(2,3)12-7(11)10-6-4-5-9/h23-24H,3-22H2,1-2H3;4-6,9H2,1-3H3,(H,10,11) |
| InChIKey | CLCINIWKSNEXMJ-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 586.90 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-(3-aminopropyl)carbamate;8-formyloxyoctyl 2-hexyldecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-(3-aminopropyl)carbamate;8-formyloxyoctyl 2-hexyldecanoate?
The IUPAC name of tert-butyl N-(3-aminopropyl)carbamate;8-formyloxyoctyl 2-hexyldecanoate (CID 178056216) is tert-butyl N-(3-aminopropyl)carbamate;8-formyloxyoctyl 2-hexyldecanoate.
What is the SMILES notation for tert-butyl N-(3-aminopropyl)carbamate;8-formyloxyoctyl 2-hexyldecanoate?
The canonical SMILES for tert-butyl N-(3-aminopropyl)carbamate;8-formyloxyoctyl 2-hexyldecanoate is CC(C)(C)OC(=O)NCCCN.CCCCCCCCC(CCCCCC)C(=O)OCCCCCCCCOC=O.
What is the InChIKey of tert-butyl N-(3-aminopropyl)carbamate;8-formyloxyoctyl 2-hexyldecanoate?
The InChIKey is CLCINIWKSNEXMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H48O4.C8H18N2O2/c1-3-5-7-9-12-16-20-24(19-15-8-6-4-2)25(27)29-22-18-14-11-10-13-17-21-28-23-26;1-8(2,3)12-7(11)10-6-4-5-9/h23-24H,3-22H2,1-2H3;4-6,9H2,1-3H3,(H,10,11).
What are the key properties of tert-butyl N-(3-aminopropyl)carbamate;8-formyloxyoctyl 2-hexyldecanoate?
tert-butyl N-(3-aminopropyl)carbamate;8-formyloxyoctyl 2-hexyldecanoate has a molecular weight of 586.90 g/mol, XLogP of 8.24, 26 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(3-aminopropyl)carbamate;8-formyloxyoctyl 2-hexyldecanoate is sourced from PubChem (CID 178056216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).