C23H45N5O5 — CID 44626867
tert-butyl N-[6-[[(2S)-6-amino-1-[(6-amino-6-oxohexyl)amino]-1-oxohexan-2-yl]amino]-6-oxohexyl]carbamate (PubChem CID 44626867) has the molecular formula C23H45N5O5 and a molecular weight of 471.64 g/mol. Its IUPAC name is tert-butyl N-[6-[[(2S)-6-amino-1-[(6-amino-6-oxohexyl)amino]-1-oxohexan-2-yl]amino]-6-oxohexyl]carbamate.
| Compound Name | tert-butyl N-[6-[[(2S)-6-amino-1-[(6-amino-6-oxohexyl)amino]-1-oxohexan-2-yl]amino]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 44626867 |
| Molecular Formula | C23H45N5O5 |
| Molecular Weight | 471.64 g/mol |
| Exact Mass | 471.34 |
| IUPAC Name | tert-butyl N-[6-[[(2S)-6-amino-1-[(6-amino-6-oxohexyl)amino]-1-oxohexan-2-yl]amino]-6-oxohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCC(=O)N[C@@H](CCCCN)C(=O)NCCCCCC(N)=O |
| InChI | InChI=1S/C23H45N5O5/c1-23(2,3)33-22(32)27-17-11-5-7-14-20(30)28-18(12-8-9-15-24)21(31)26-16-10-4-6-13-19(25)29/h18H,4-17,24H2,1-3H3,(H2,25,29)(H,26,31)(H,27,32)(H,28,30)/t18-/m0/s1 |
| InChIKey | LEVBULCRNHIUKC-SFHVURJKSA-N |
| XLogP | 1.85 |
| TPSA | 165.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.64 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|