C22H45N3O4 — CID 146328608
(2S)-6-amino-N-(4-propan-2-yloxybutyl)-2-(6-propan-2-yloxyhexanoylamino)hexanamide (PubChem CID 146328608) has the molecular formula C22H45N3O4 and a molecular weight of 415.62 g/mol. Its IUPAC name is (2S)-6-amino-N-(4-propan-2-yloxybutyl)-2-(6-propan-2-yloxyhexanoylamino)hexanamide.
| Compound Name | (2S)-6-amino-N-(4-propan-2-yloxybutyl)-2-(6-propan-2-yloxyhexanoylamino)hexanamide |
|---|---|
| PubChem CID | 146328608 |
| Molecular Formula | C22H45N3O4 |
| Molecular Weight | 415.62 g/mol |
| Exact Mass | 415.34 |
| IUPAC Name | (2S)-6-amino-N-(4-propan-2-yloxybutyl)-2-(6-propan-2-yloxyhexanoylamino)hexanamide |
| SMILES | CC(C)OCCCCCC(=O)N[C@@H](CCCCN)C(=O)NCCCCOC(C)C |
| InChI | InChI=1S/C22H45N3O4/c1-18(2)28-16-10-5-6-13-21(26)25-20(12-7-8-14-23)22(27)24-15-9-11-17-29-19(3)4/h18-20H,5-17,23H2,1-4H3,(H,24,27)(H,25,26)/t20-/m0/s1 |
| InChIKey | LPUIVYUKQBYDRB-FQEVSTJZSA-N |
| XLogP | 2.91 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.62 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|