C13H26N4O4 — CID 10566282
tert-butyl N-[(2S)-4-amino-1-(4-aminobutylamino)-1,4-dioxobutan-2-yl]carbamate (PubChem CID 10566282) has the molecular formula C13H26N4O4 and a molecular weight of 302.38 g/mol. Its IUPAC name is tert-butyl N-[(2S)-4-amino-1-(4-aminobutylamino)-1,4-dioxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-4-amino-1-(4-aminobutylamino)-1,4-dioxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 10566282 |
| Molecular Formula | C13H26N4O4 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | tert-butyl N-[(2S)-4-amino-1-(4-aminobutylamino)-1,4-dioxobutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(N)=O)C(=O)NCCCCN |
| InChI | InChI=1S/C13H26N4O4/c1-13(2,3)21-12(20)17-9(8-10(15)18)11(19)16-7-5-4-6-14/h9H,4-8,14H2,1-3H3,(H2,15,18)(H,16,19)(H,17,20)/t9-/m0/s1 |
| InChIKey | YEJXREZNFLXBQX-VIFPVBQESA-N |
| XLogP | -0.39 |
| TPSA | 136.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|