C28H53N5O8 — CID 167423911
butyl 2-[[6-amino-2-[2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoylamino]hexanoyl]amino]acetate (PubChem CID 167423911) has the molecular formula C28H53N5O8 and a molecular weight of 587.76 g/mol. Its IUPAC name is butyl 2-[[6-amino-2-[2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoylamino]hexanoyl]amino]acetate.
| Compound Name | butyl 2-[[6-amino-2-[2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoylamino]hexanoyl]amino]acetate |
|---|---|
| PubChem CID | 167423911 |
| Molecular Formula | C28H53N5O8 |
| Molecular Weight | 587.76 g/mol |
| Exact Mass | 587.39 |
| IUPAC Name | butyl 2-[[6-amino-2-[2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoylamino]hexanoyl]amino]acetate |
| SMILES | CCCCOC(=O)CNC(=O)C(CCCCN)NC(=O)C(CCCCNC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H53N5O8/c1-8-9-18-39-22(34)19-31-23(35)20(14-10-12-16-29)32-24(36)21(33-26(38)41-28(5,6)7)15-11-13-17-30-25(37)40-27(2,3)4/h20-21H,8-19,29H2,1-7H3,(H,30,37)(H,31,35)(H,32,36)(H,33,38) |
| InChIKey | XKCJGXJMEBDBLD-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 187.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.76 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|