C33H60N4O10 — CID 167423905
dibutyl 2-[[2-[[2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-5-butoxy-5-oxopentanoyl]amino]pentanedioate (PubChem CID 167423905) has the molecular formula C33H60N4O10 and a molecular weight of 672.86 g/mol. Its IUPAC name is dibutyl 2-[[2-[[2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-5-butoxy-5-oxopentanoyl]amino]pentanedioate.
| Compound Name | dibutyl 2-[[2-[[2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-5-butoxy-5-oxopentanoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 167423905 |
| Molecular Formula | C33H60N4O10 |
| Molecular Weight | 672.86 g/mol |
| Exact Mass | 672.43 |
| IUPAC Name | dibutyl 2-[[2-[[2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-5-butoxy-5-oxopentanoyl]amino]pentanedioate |
| SMILES | CCCCOC(=O)CCC(NC(=O)C(N)CCCCNC(=O)OC(C)(C)C)C(=O)NC(CCC(=O)OCCCC)C(=O)OCCCC |
| InChI | InChI=1S/C33H60N4O10/c1-7-10-21-44-27(38)18-16-25(36-29(40)24(34)15-13-14-20-35-32(43)47-33(4,5)6)30(41)37-26(31(42)46-23-12-9-3)17-19-28(39)45-22-11-8-2/h24-26H,7-23,34H2,1-6H3,(H,35,43)(H,36,40)(H,37,41) |
| InChIKey | HSQFJFFPSHQILX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 201.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.86 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|