C56H105N3O7 — CID 170781222
5-O-tert-butyl 1-O-[(9Z,27Z)-hexatriaconta-9,27-dien-18-yl] (2S)-2-[[(2S)-2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]pentanedioate (PubChem CID 170781222) has the molecular formula C56H105N3O7 and a molecular weight of 932.47 g/mol. Its IUPAC name is 5-O-tert-butyl 1-O-[(9Z,27Z)-hexatriaconta-9,27-dien-18-yl] (2S)-2-[[(2S)-2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]pentanedioate.
| Compound Name | 5-O-tert-butyl 1-O-[(9Z,27Z)-hexatriaconta-9,27-dien-18-yl] (2S)-2-[[(2S)-2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 170781222 |
| Molecular Formula | C56H105N3O7 |
| Molecular Weight | 932.47 g/mol |
| Exact Mass | 931.80 |
| IUPAC Name | 5-O-tert-butyl 1-O-[(9Z,27Z)-hexatriaconta-9,27-dien-18-yl] (2S)-2-[[(2S)-2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]pentanedioate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCC(CCCCCCC/C=C\CCCCCCCC)OC(=O)[C@H](CCC(=O)OC(C)(C)C)NC(=O)[C@@H](N)CCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C56H105N3O7/c1-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39-43-48(42-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-2)64-53(62)50(45-46-51(60)65-55(3,4)5)59-52(61)49(57)44-40-41-47-58-54(63)66-56(6,7)8/h23-26,48-50H,9-22,27-47,57H2,1-8H3,(H,58,63)(H,59,61)/b25-23-,26-24-/t48?,49-,50-/m0/s1 |
| InChIKey | PBILNPOTEIXWFP-DDXPYFCWSA-N |
| XLogP | 14.99 |
| TPSA | 146.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 932.47 |
| LogP ≤ 5 | 14.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|