C33H57N3O7 — CID 91131220
(2,5-dihydroxypyrrol-1-yl) 6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(octadec-9-enoylamino)hexanoate (PubChem CID 91131220) has the molecular formula C33H57N3O7 and a molecular weight of 607.83 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(octadec-9-enoylamino)hexanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(octadec-9-enoylamino)hexanoate |
|---|---|
| PubChem CID | 91131220 |
| Molecular Formula | C33H57N3O7 |
| Molecular Weight | 607.83 g/mol |
| Exact Mass | 607.42 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(octadec-9-enoylamino)hexanoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)NC(CCCCNC(=O)OC(C)(C)C)C(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C33H57N3O7/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23-28(37)35-27(31(40)43-36-29(38)24-25-30(36)39)22-20-21-26-34-32(41)42-33(2,3)4/h12-13,24-25,27,38-39H,5-11,14-23,26H2,1-4H3,(H,34,41)(H,35,37) |
| InChIKey | HLZKZUHRHNBYMO-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.83 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|