C42H79N3O2 — CID 123190154
N-[6-amino-1-(octadec-9-enylamino)-1-oxohexan-2-yl]octadeca-9,12-dienamide (PubChem CID 123190154) has the molecular formula C42H79N3O2 and a molecular weight of 658.11 g/mol. Its IUPAC name is N-[6-amino-1-(octadec-9-enylamino)-1-oxohexan-2-yl]octadeca-9,12-dienamide.
| Compound Name | N-[6-amino-1-(octadec-9-enylamino)-1-oxohexan-2-yl]octadeca-9,12-dienamide |
|---|---|
| PubChem CID | 123190154 |
| Molecular Formula | C42H79N3O2 |
| Molecular Weight | 658.11 g/mol |
| Exact Mass | 657.62 |
| IUPAC Name | N-[6-amino-1-(octadec-9-enylamino)-1-oxohexan-2-yl]octadeca-9,12-dienamide |
| SMILES | CCCCCC=CCC=CCCCCCCCC(=O)NC(CCCCN)C(=O)NCCCCCCCCC=CCCCCCCCC |
| InChI | InChI=1S/C42H79N3O2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-35-39-44-42(47)40(36-33-34-38-43)45-41(46)37-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h12,14,17-20,40H,3-11,13,15-16,21-39,43H2,1-2H3,(H,44,47)(H,45,46) |
| InChIKey | DSGVHVYAOAHXEV-UHFFFAOYSA-N |
| XLogP | 11.57 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.11 |
| LogP ≤ 5 | 11.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|