C36H72N6O3 — CID 58668171
(Z)-N-[1-[3-[4-(3-acetamidopropylamino)butylamino]propylamino]-6-amino-1-oxohexan-2-yl]octadec-9-enamide (PubChem CID 58668171) has the molecular formula C36H72N6O3 and a molecular weight of 637.01 g/mol. Its IUPAC name is (Z)-N-[1-[3-[4-(3-acetamidopropylamino)butylamino]propylamino]-6-amino-1-oxohexan-2-yl]octadec-9-enamide.
| Compound Name | (Z)-N-[1-[3-[4-(3-acetamidopropylamino)butylamino]propylamino]-6-amino-1-oxohexan-2-yl]octadec-9-enamide |
|---|---|
| PubChem CID | 58668171 |
| Molecular Formula | C36H72N6O3 |
| Molecular Weight | 637.01 g/mol |
| Exact Mass | 636.57 |
| IUPAC Name | (Z)-N-[1-[3-[4-(3-acetamidopropylamino)butylamino]propylamino]-6-amino-1-oxohexan-2-yl]octadec-9-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)NC(CCCCN)C(=O)NCCCNCCCCNCCCNC(C)=O |
| InChI | InChI=1S/C36H72N6O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-25-35(44)42-34(24-18-19-26-37)36(45)41-32-23-30-39-28-21-20-27-38-29-22-31-40-33(2)43/h10-11,34,38-39H,3-9,12-32,37H2,1-2H3,(H,40,43)(H,41,45)(H,42,44)/b11-10- |
| InChIKey | AUEYZEKTYXQNSM-KHPPLWFESA-N |
| XLogP | 5.63 |
| TPSA | 137.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.01 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|