C38H66N6O6 — CID 44612681
(2S)-2-[[(2S)-6-amino-2-[[(2S)-2-[[(2S)-6-amino-2-[[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]amino]hexanoyl]amino]propanoyl]amino]hexanoyl]amino]propanoic acid (PubChem CID 44612681) has the molecular formula C38H66N6O6 and a molecular weight of 702.98 g/mol. Its IUPAC name is (2S)-2-[[(2S)-6-amino-2-[[(2S)-2-[[(2S)-6-amino-2-[[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]amino]hexanoyl]amino]propanoyl]amino]hexanoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-6-amino-2-[[(2S)-2-[[(2S)-6-amino-2-[[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]amino]hexanoyl]amino]propanoyl]amino]hexanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 44612681 |
| Molecular Formula | C38H66N6O6 |
| Molecular Weight | 702.98 g/mol |
| Exact Mass | 702.50 |
| IUPAC Name | (2S)-2-[[(2S)-6-amino-2-[[(2S)-2-[[(2S)-6-amino-2-[[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]amino]hexanoyl]amino]propanoyl]amino]hexanoyl]amino]propanoic acid |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C38H66N6O6/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-27-34(45)43-32(25-21-23-28-39)36(47)41-30(2)35(46)44-33(26-22-24-29-40)37(48)42-31(3)38(49)50/h8-9,11-12,14-15,17-18,30-33H,4-7,10,13,16,19-29,39-40H2,1-3H3,(H,41,47)(H,42,48)(H,43,45)(H,44,46)(H,49,50)/b9-8-,12-11-,15-14-,18-17-/t30-,31-,32-,33-/m0/s1 |
| InChIKey | RKLQZOUAGSFHSQ-IJMZZJRWSA-N |
| XLogP | 4.45 |
| TPSA | 205.74 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.98 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|