C27H52N2O5 — CID 173040137
6-amino-2-(propanoylamino)hexanoic acid;octadec-9-enoic acid (PubChem CID 173040137) has the molecular formula C27H52N2O5 and a molecular weight of 484.72 g/mol. Its IUPAC name is 6-amino-2-(propanoylamino)hexanoic acid;octadec-9-enoic acid.
| Compound Name | 6-amino-2-(propanoylamino)hexanoic acid;octadec-9-enoic acid |
|---|---|
| PubChem CID | 173040137 |
| Molecular Formula | C27H52N2O5 |
| Molecular Weight | 484.72 g/mol |
| Exact Mass | 484.39 |
| IUPAC Name | 6-amino-2-(propanoylamino)hexanoic acid;octadec-9-enoic acid |
| SMILES | CCC(=O)NC(CCCCN)C(=O)O.CCCCCCCCC=CCCCCCCCC(=O)O |
| InChI | InChI=1S/C18H34O2.C9H18N2O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-8(12)11-7(9(13)14)5-3-4-6-10/h9-10H,2-8,11-17H2,1H3,(H,19,20);7H,2-6,10H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | VGKUMBPSXXSBLY-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.72 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|