C31H58N4O8 — CID 101257021
methyl (2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[[(2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(octanoylamino)hexanoyl]amino]hexanoate (PubChem CID 101257021) has the molecular formula C31H58N4O8 and a molecular weight of 614.83 g/mol. Its IUPAC name is methyl (2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[[(2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(octanoylamino)hexanoyl]amino]hexanoate.
| Compound Name | methyl (2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[[(2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(octanoylamino)hexanoyl]amino]hexanoate |
|---|---|
| PubChem CID | 101257021 |
| Molecular Formula | C31H58N4O8 |
| Molecular Weight | 614.83 g/mol |
| Exact Mass | 614.43 |
| IUPAC Name | methyl (2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[[(2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(octanoylamino)hexanoyl]amino]hexanoate |
| SMILES | CCCCCCCC(=O)N[C@@H](CCCCNC(=O)OC(C)(C)C)C(=O)N[C@@H](CCCCNC(=O)OC(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C31H58N4O8/c1-9-10-11-12-13-20-25(36)34-23(18-14-16-21-32-28(39)42-30(2,3)4)26(37)35-24(27(38)41-8)19-15-17-22-33-29(40)43-31(5,6)7/h23-24H,9-22H2,1-8H3,(H,32,39)(H,33,40)(H,34,36)(H,35,37)/t23-,24-/m0/s1 |
| InChIKey | XLDOSPPISBQETO-ZEQRLZLVSA-N |
| XLogP | 4.88 |
| TPSA | 161.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.83 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|