C29H55N3O4 — CID 146945145
tert-butyl N-[6-amino-5-[[(Z)-octadec-9-enoyl]amino]-6-oxohexyl]carbamate (PubChem CID 146945145) has the molecular formula C29H55N3O4 and a molecular weight of 509.78 g/mol. Its IUPAC name is tert-butyl N-[6-amino-5-[[(Z)-octadec-9-enoyl]amino]-6-oxohexyl]carbamate.
| Compound Name | tert-butyl N-[6-amino-5-[[(Z)-octadec-9-enoyl]amino]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 146945145 |
| Molecular Formula | C29H55N3O4 |
| Molecular Weight | 509.78 g/mol |
| Exact Mass | 509.42 |
| IUPAC Name | tert-butyl N-[6-amino-5-[[(Z)-octadec-9-enoyl]amino]-6-oxohexyl]carbamate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)NC(CCCCNC(=O)OC(C)(C)C)C(N)=O |
| InChI | InChI=1S/C29H55N3O4/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23-26(33)32-25(27(30)34)22-20-21-24-31-28(35)36-29(2,3)4/h12-13,25H,5-11,14-24H2,1-4H3,(H2,30,34)(H,31,35)(H,32,33)/b13-12- |
| InChIKey | AHQNQOVKVPMMOH-SEYXRHQNSA-N |
| XLogP | 6.69 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.78 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|