C33H57N3O7 — CID 58668212
(2,5-dioxopyrrolidin-1-yl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[[(Z)-octadec-9-enoyl]amino]hexanoate (PubChem CID 58668212) has the molecular formula C33H57N3O7 and a molecular weight of 607.83 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[[(Z)-octadec-9-enoyl]amino]hexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[[(Z)-octadec-9-enoyl]amino]hexanoate |
|---|---|
| PubChem CID | 58668212 |
| Molecular Formula | C33H57N3O7 |
| Molecular Weight | 607.83 g/mol |
| Exact Mass | 607.42 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[[(Z)-octadec-9-enoyl]amino]hexanoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)NCCCCC(NC(=O)OC(C)(C)C)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C33H57N3O7/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23-28(37)34-26-21-20-22-27(35-32(41)42-33(2,3)4)31(40)43-36-29(38)24-25-30(36)39/h12-13,27H,5-11,14-26H2,1-4H3,(H,34,37)(H,35,41)/b13-12- |
| InChIKey | UCPWXTOUZNNVDG-SEYXRHQNSA-N |
| XLogP | 6.81 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.83 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|