C16H25N3O7 — CID 88950084
(2,5-dioxopyrrolidin-1-yl) 2-(ethoxycarbonylamino)-6-(propanoylamino)hexanoate (PubChem CID 88950084) has the molecular formula C16H25N3O7 and a molecular weight of 371.39 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-(ethoxycarbonylamino)-6-(propanoylamino)hexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-(ethoxycarbonylamino)-6-(propanoylamino)hexanoate |
|---|---|
| PubChem CID | 88950084 |
| Molecular Formula | C16H25N3O7 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-(ethoxycarbonylamino)-6-(propanoylamino)hexanoate |
| SMILES | CCOC(=O)NC(CCCCNC(=O)CC)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C16H25N3O7/c1-3-12(20)17-10-6-5-7-11(18-16(24)25-4-2)15(23)26-19-13(21)8-9-14(19)22/h11H,3-10H2,1-2H3,(H,17,20)(H,18,24) |
| InChIKey | CHUWGJNATQFRQH-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|