C17H32N4O6 — CID 160722960
6-acetamido-2-((113C)methyl(15N)amino)hexanamide;carbane;(2,5-dioxopyrrolidin-1-yl) (313C)propanoate (PubChem CID 160722960) has the molecular formula C17H32N4O6 and a molecular weight of 392.44 g/mol. Its IUPAC name is 6-acetamido-2-((113C)methyl(15N)amino)hexanamide;carbane;(2,5-dioxopyrrolidin-1-yl) (313C)propanoate.
| Compound Name | 6-acetamido-2-((113C)methyl(15N)amino)hexanamide;carbane;(2,5-dioxopyrrolidin-1-yl) (313C)propanoate |
|---|---|
| PubChem CID | 160722960 |
| Molecular Formula | C17H32N4O6 |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | 6-acetamido-2-((113C)methyl(15N)amino)hexanamide;carbane;(2,5-dioxopyrrolidin-1-yl) (313C)propanoate |
| SMILES | CC(=O)NCCCCC([15NH][13CH3])C(N)=O.[13CH3]CC(=O)ON1C(=O)CCC1=O.[13CH4] |
| InChI | InChI=1S/C9H19N3O2.C7H9NO4.CH4/c1-7(13)12-6-4-3-5-8(11-2)9(10)14;1-2-7(11)12-8-5(9)3-4-6(8)10;/h8,11H,3-6H2,1-2H3,(H2,10,14)(H,12,13);2-4H2,1H3;1H4/i2+1,11+1;2*1+1 |
| InChIKey | RTIMVXHAIBONEB-CCTIUVBDSA-N |
| XLogP | 0.01 |
| TPSA | 147.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|