C18H37N5O5 — CID 161410533
N-(5-aminopentyl)acetamide;(2,5-dioxopyrrolidin-1-yl) acetate;pentane-1,5-diamine (PubChem CID 161410533) has the molecular formula C18H37N5O5 and a molecular weight of 403.52 g/mol. Its IUPAC name is N-(5-aminopentyl)acetamide;(2,5-dioxopyrrolidin-1-yl) acetate;pentane-1,5-diamine.
| Compound Name | N-(5-aminopentyl)acetamide;(2,5-dioxopyrrolidin-1-yl) acetate;pentane-1,5-diamine |
|---|---|
| PubChem CID | 161410533 |
| Molecular Formula | C18H37N5O5 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.28 |
| IUPAC Name | N-(5-aminopentyl)acetamide;(2,5-dioxopyrrolidin-1-yl) acetate;pentane-1,5-diamine |
| SMILES | CC(=O)NCCCCCN.CC(=O)ON1C(=O)CCC1=O.NCCCCCN |
| InChI | InChI=1S/C7H16N2O.C6H7NO4.C5H14N2/c1-7(10)9-6-4-2-3-5-8;1-4(8)11-7-5(9)2-3-6(7)10;6-4-2-1-3-5-7/h2-6,8H2,1H3,(H,9,10);2-3H2,1H3;1-7H2 |
| InChIKey | VVKGQSNXDAIHOQ-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 170.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|