C20H42N2O2 — CID 175547048
N-(18-amino-7-hydroxyoctadecyl)acetamide (PubChem CID 175547048) has the molecular formula C20H42N2O2 and a molecular weight of 342.57 g/mol. Its IUPAC name is N-(18-amino-7-hydroxyoctadecyl)acetamide.
| Compound Name | N-(18-amino-7-hydroxyoctadecyl)acetamide |
|---|---|
| PubChem CID | 175547048 |
| Molecular Formula | C20H42N2O2 |
| Molecular Weight | 342.57 g/mol |
| Exact Mass | 342.32 |
| IUPAC Name | N-(18-amino-7-hydroxyoctadecyl)acetamide |
| SMILES | CC(=O)NCCCCCCC(O)CCCCCCCCCCCN |
| InChI | InChI=1S/C20H42N2O2/c1-19(23)22-18-14-10-8-12-16-20(24)15-11-7-5-3-2-4-6-9-13-17-21/h20,24H,2-18,21H2,1H3,(H,22,23) |
| InChIKey | CNHKTAFUAHYLIG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.57 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|