C23H41N5O8 — CID 101082128
[(2R)-2-hydroxypropanoyl] (2R)-2-[[(2R)-2-[[(2S)-6-acetamido-2-(6-aminohexanoylamino)hexanoyl]amino]propanoyl]amino]propanoate (PubChem CID 101082128) has the molecular formula C23H41N5O8 and a molecular weight of 515.61 g/mol. Its IUPAC name is [(2R)-2-hydroxypropanoyl] (2R)-2-[[(2R)-2-[[(2S)-6-acetamido-2-(6-aminohexanoylamino)hexanoyl]amino]propanoyl]amino]propanoate.
| Compound Name | [(2R)-2-hydroxypropanoyl] (2R)-2-[[(2R)-2-[[(2S)-6-acetamido-2-(6-aminohexanoylamino)hexanoyl]amino]propanoyl]amino]propanoate |
|---|---|
| PubChem CID | 101082128 |
| Molecular Formula | C23H41N5O8 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.30 |
| IUPAC Name | [(2R)-2-hydroxypropanoyl] (2R)-2-[[(2R)-2-[[(2S)-6-acetamido-2-(6-aminohexanoylamino)hexanoyl]amino]propanoyl]amino]propanoate |
| SMILES | CC(=O)NCCCC[C@H](NC(=O)CCCCCN)C(=O)N[C@H](C)C(=O)N[C@H](C)C(=O)OC(=O)[C@@H](C)O |
| InChI | InChI=1S/C23H41N5O8/c1-14(20(32)27-15(2)22(34)36-23(35)16(3)29)26-21(33)18(10-7-9-13-25-17(4)30)28-19(31)11-6-5-8-12-24/h14-16,18,29H,5-13,24H2,1-4H3,(H,25,30)(H,26,33)(H,27,32)(H,28,31)/t14-,15-,16-,18+/m1/s1 |
| InChIKey | OUXMEOSKXORUBB-KONPQCLYSA-N |
| XLogP | -1.24 |
| TPSA | 206.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|