C9H23Cl2N3O — CID 74764694
N-[4-(3-aminopropylamino)butyl]acetamide;hydron;dichloride (PubChem CID 74764694) has the molecular formula C9H23Cl2N3O and a molecular weight of 260.21 g/mol. Its IUPAC name is N-[4-(3-aminopropylamino)butyl]acetamide;hydron;dichloride.
| Compound Name | N-[4-(3-aminopropylamino)butyl]acetamide;hydron;dichloride |
|---|---|
| PubChem CID | 74764694 |
| Molecular Formula | C9H23Cl2N3O |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | N-[4-(3-aminopropylamino)butyl]acetamide;hydron;dichloride |
| SMILES | CC(=O)NCCCCNCCCN.[Cl-].[Cl-].[H+].[H+] |
| InChI | InChI=1S/C9H21N3O.2ClH/c1-9(13)12-8-3-2-6-11-7-4-5-10;;/h11H,2-8,10H2,1H3,(H,12,13);2*1H |
| InChIKey | BWGUIRARVGYOIR-UHFFFAOYSA-N |
| XLogP | -5.93 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | -5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|