C13H28N4O2S — CID 118721820
2-(2-acetamidoethylsulfanyl)-N-[4-(3-aminopropylamino)butyl]acetamide (PubChem CID 118721820) has the molecular formula C13H28N4O2S and a molecular weight of 304.46 g/mol. Its IUPAC name is 2-(2-acetamidoethylsulfanyl)-N-[4-(3-aminopropylamino)butyl]acetamide.
| Compound Name | 2-(2-acetamidoethylsulfanyl)-N-[4-(3-aminopropylamino)butyl]acetamide |
|---|---|
| PubChem CID | 118721820 |
| Molecular Formula | C13H28N4O2S |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 2-(2-acetamidoethylsulfanyl)-N-[4-(3-aminopropylamino)butyl]acetamide |
| SMILES | CC(=O)NCCSCC(=O)NCCCCNCCCN |
| InChI | InChI=1S/C13H28N4O2S/c1-12(18)16-9-10-20-11-13(19)17-8-3-2-6-15-7-4-5-14/h15H,2-11,14H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | DWOIJKDFMKWVOA-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|