C11H26N4O — CID 59687521
N-[2-[4-(3-aminopropylamino)butylamino]ethyl]acetamide (PubChem CID 59687521) has the molecular formula C11H26N4O and a molecular weight of 230.36 g/mol. Its IUPAC name is N-[2-[4-(3-aminopropylamino)butylamino]ethyl]acetamide.
| Compound Name | N-[2-[4-(3-aminopropylamino)butylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 59687521 |
| Molecular Formula | C11H26N4O |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.21 |
| IUPAC Name | N-[2-[4-(3-aminopropylamino)butylamino]ethyl]acetamide |
| SMILES | CC(=O)NCCNCCCCNCCCN |
| InChI | InChI=1S/C11H26N4O/c1-11(16)15-10-9-14-7-3-2-6-13-8-4-5-12/h13-14H,2-10,12H2,1H3,(H,15,16) |
| InChIKey | PVWMQEBZLWXCSD-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|