N,N'-bis(3-aminopropyl)butane-1,4-diamine;butanedioic acid

C14H32N4O4 — CID 174466716

IUPACN,N'-bis(3-aminopropyl)butane-1,4-diamine;butanedioic acid
SMILESNCCCNCCCCNCCCN.O=C(O)CCC(=O)O
InChIInChI=1S/C10H26N4.C4H6O4/c11-5-3-9-13-7-1-2-8-14-10-4-6-12;5-3(6)1-2-4(7)8/h13-14H,1-12H2;1-2H2,(H,5,6)(H,7,8)
InChIKeyFCJSRTLZFBFBPB-UHFFFAOYSA-N
MW320.43 g/mol
LogP-0.42
Rot. Bonds14

About N,N'-bis(3-aminopropyl)butane-1,4-diamine;butanedioic acid

N,N'-bis(3-aminopropyl)butane-1,4-diamine;butanedioic acid (PubChem CID 174466716) has the molecular formula C14H32N4O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is N,N'-bis(3-aminopropyl)butane-1,4-diamine;butanedioic acid.

Molecular Properties

Compound NameN,N'-bis(3-aminopropyl)butane-1,4-diamine;butanedioic acid
PubChem CID174466716
Molecular FormulaC14H32N4O4
Molecular Weight320.43 g/mol
Exact Mass320.24
IUPAC NameN,N'-bis(3-aminopropyl)butane-1,4-diamine;butanedioic acid
SMILESNCCCNCCCCNCCCN.O=C(O)CCC(=O)O
InChIInChI=1S/C10H26N4.C4H6O4/c11-5-3-9-13-7-1-2-8-14-10-4-6-12;5-3(6)1-2-4(7)8/h13-14H,1-12H2;1-2H2,(H,5,6)(H,7,8)
InChIKeyFCJSRTLZFBFBPB-UHFFFAOYSA-N
XLogP-0.42
TPSA150.70 Ų
H-Bond Donors6
H-Bond Acceptors6
Rotatable Bonds14
Heavy Atoms22
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500320.43
LogP ≤ 5-0.42
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze N,N'-bis(3-aminopropyl)butane-1,4-diamine;butanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N,N'-bis(3-aminopropyl)butane-1,4-diamine;butanedioic acid?
The IUPAC name of N,N'-bis(3-aminopropyl)butane-1,4-diamine;butanedioic acid (CID 174466716) is N,N'-bis(3-aminopropyl)butane-1,4-diamine;butanedioic acid.
What is the SMILES notation for N,N'-bis(3-aminopropyl)butane-1,4-diamine;butanedioic acid?
The canonical SMILES for N,N'-bis(3-aminopropyl)butane-1,4-diamine;butanedioic acid is NCCCNCCCCNCCCN.O=C(O)CCC(=O)O.
What is the InChIKey of N,N'-bis(3-aminopropyl)butane-1,4-diamine;butanedioic acid?
The InChIKey is FCJSRTLZFBFBPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H26N4.C4H6O4/c11-5-3-9-13-7-1-2-8-14-10-4-6-12;5-3(6)1-2-4(7)8/h13-14H,1-12H2;1-2H2,(H,5,6)(H,7,8).
What are the key properties of N,N'-bis(3-aminopropyl)butane-1,4-diamine;butanedioic acid?
N,N'-bis(3-aminopropyl)butane-1,4-diamine;butanedioic acid has a molecular weight of 320.43 g/mol, XLogP of -0.42, 14 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-bis(3-aminopropyl)butane-1,4-diamine;butanedioic acid is sourced from PubChem (CID 174466716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).