C14H32N4O4 — CID 174466716
N,N'-bis(3-aminopropyl)butane-1,4-diamine;butanedioic acid (PubChem CID 174466716) has the molecular formula C14H32N4O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is N,N'-bis(3-aminopropyl)butane-1,4-diamine;butanedioic acid.
| Compound Name | N,N'-bis(3-aminopropyl)butane-1,4-diamine;butanedioic acid |
|---|---|
| PubChem CID | 174466716 |
| Molecular Formula | C14H32N4O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | N,N'-bis(3-aminopropyl)butane-1,4-diamine;butanedioic acid |
| SMILES | NCCCNCCCCNCCCN.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C10H26N4.C4H6O4/c11-5-3-9-13-7-1-2-8-14-10-4-6-12;5-3(6)1-2-4(7)8/h13-14H,1-12H2;1-2H2,(H,5,6)(H,7,8) |
| InChIKey | FCJSRTLZFBFBPB-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 150.70 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|