C12H25N3O8 — CID 87573177
N'-(2-aminoethyl)ethane-1,2-diamine;bis(butanedioic acid) (PubChem CID 87573177) has the molecular formula C12H25N3O8 and a molecular weight of 339.35 g/mol. Its IUPAC name is N'-(2-aminoethyl)ethane-1,2-diamine;bis(butanedioic acid).
| Compound Name | N'-(2-aminoethyl)ethane-1,2-diamine;bis(butanedioic acid) |
|---|---|
| PubChem CID | 87573177 |
| Molecular Formula | C12H25N3O8 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | N'-(2-aminoethyl)ethane-1,2-diamine;bis(butanedioic acid) |
| SMILES | NCCNCCN.O=C(O)CCC(=O)O.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C4H13N3.2C4H6O4/c5-1-3-7-4-2-6;2*5-3(6)1-2-4(7)8/h7H,1-6H2;2*1-2H2,(H,5,6)(H,7,8) |
| InChIKey | WVMQIHZGHLSOGC-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 213.27 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|