C11H23N3O4 — CID 173087831
N'-(3-aminopropyl)butane-1,4-diamine;but-2-enedioic acid (PubChem CID 173087831) has the molecular formula C11H23N3O4 and a molecular weight of 261.32 g/mol. Its IUPAC name is N'-(3-aminopropyl)butane-1,4-diamine;but-2-enedioic acid.
| Compound Name | N'-(3-aminopropyl)butane-1,4-diamine;but-2-enedioic acid |
|---|---|
| PubChem CID | 173087831 |
| Molecular Formula | C11H23N3O4 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | N'-(3-aminopropyl)butane-1,4-diamine;but-2-enedioic acid |
| SMILES | NCCCCNCCCN.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C7H19N3.C4H4O4/c8-4-1-2-6-10-7-3-5-9;5-3(6)1-2-4(7)8/h10H,1-9H2;1-2H,(H,5,6)(H,7,8) |
| InChIKey | SZMIHSNHQDWVHK-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|