C10H28N4O3Ti — CID 90134017
N,N'-bis(3-aminopropyl)butane-1,4-diamine;dihydroxy(oxo)titanium (PubChem CID 90134017) has the molecular formula C10H28N4O3Ti and a molecular weight of 300.23 g/mol. Its IUPAC name is N,N'-bis(3-aminopropyl)butane-1,4-diamine;dihydroxy(oxo)titanium.
| Compound Name | N,N'-bis(3-aminopropyl)butane-1,4-diamine;dihydroxy(oxo)titanium |
|---|---|
| PubChem CID | 90134017 |
| Molecular Formula | C10H28N4O3Ti |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | N,N'-bis(3-aminopropyl)butane-1,4-diamine;dihydroxy(oxo)titanium |
| SMILES | NCCCNCCCCNCCCN.O=[Ti](O)O |
| InChI | InChI=1S/C10H26N4.2H2O.O.Ti/c11-5-3-9-13-7-1-2-8-14-10-4-6-12;;;;/h13-14H,1-12H2;2*1H2;;/q;;;;+2/p-2 |
| InChIKey | RHAKXCMRMRCJCV-UHFFFAOYSA-L |
| XLogP | -1.59 |
| TPSA | 133.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|