C9H24Cl3N3O3 — CID 135056308
N-[4-(3-aminopropylamino)butyl]-2,2-dihydroxyacetamide;trihydrochloride (PubChem CID 135056308) has the molecular formula C9H24Cl3N3O3 and a molecular weight of 328.67 g/mol. Its IUPAC name is N-[4-(3-aminopropylamino)butyl]-2,2-dihydroxyacetamide;trihydrochloride.
| Compound Name | N-[4-(3-aminopropylamino)butyl]-2,2-dihydroxyacetamide;trihydrochloride |
|---|---|
| PubChem CID | 135056308 |
| Molecular Formula | C9H24Cl3N3O3 |
| Molecular Weight | 328.67 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | N-[4-(3-aminopropylamino)butyl]-2,2-dihydroxyacetamide;trihydrochloride |
| SMILES | Cl.Cl.Cl.NCCCNCCCCNC(=O)C(O)O |
| InChI | InChI=1S/C9H21N3O3.3ClH/c10-4-3-6-11-5-1-2-7-12-8(13)9(14)15;;;/h9,11,14-15H,1-7,10H2,(H,12,13);3*1H |
| InChIKey | ZEOBWMUAWYYPNT-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.67 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|