C16H38N6O — CID 23400695
2,6-diamino-N-[3-[4-(3-aminopropylamino)butylamino]propyl]hexanamide (PubChem CID 23400695) has the molecular formula C16H38N6O and a molecular weight of 330.52 g/mol. Its IUPAC name is 2,6-diamino-N-[3-[4-(3-aminopropylamino)butylamino]propyl]hexanamide.
| Compound Name | 2,6-diamino-N-[3-[4-(3-aminopropylamino)butylamino]propyl]hexanamide |
|---|---|
| PubChem CID | 23400695 |
| Molecular Formula | C16H38N6O |
| Molecular Weight | 330.52 g/mol |
| Exact Mass | 330.31 |
| IUPAC Name | 2,6-diamino-N-[3-[4-(3-aminopropylamino)butylamino]propyl]hexanamide |
| SMILES | NCCCCC(N)C(=O)NCCCNCCCCNCCCN |
| InChI | InChI=1S/C16H38N6O/c17-8-2-1-7-15(19)16(23)22-14-6-13-21-11-4-3-10-20-12-5-9-18/h15,20-21H,1-14,17-19H2,(H,22,23) |
| InChIKey | XTNRHIZWLNLONB-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 131.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.52 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|