C20H46N6O — CID 88877305
(2S)-2-amino-N-[3-[4-(3-aminopropylamino)butylamino]propyl]-6-(2-methylpropylamino)hexanamide (PubChem CID 88877305) has the molecular formula C20H46N6O and a molecular weight of 386.63 g/mol. Its IUPAC name is (2S)-2-amino-N-[3-[4-(3-aminopropylamino)butylamino]propyl]-6-(2-methylpropylamino)hexanamide.
| Compound Name | (2S)-2-amino-N-[3-[4-(3-aminopropylamino)butylamino]propyl]-6-(2-methylpropylamino)hexanamide |
|---|---|
| PubChem CID | 88877305 |
| Molecular Formula | C20H46N6O |
| Molecular Weight | 386.63 g/mol |
| Exact Mass | 386.37 |
| IUPAC Name | (2S)-2-amino-N-[3-[4-(3-aminopropylamino)butylamino]propyl]-6-(2-methylpropylamino)hexanamide |
| SMILES | CC(C)CNCCCC[C@H](N)C(=O)NCCCNCCCCNCCCN |
| InChI | InChI=1S/C20H46N6O/c1-18(2)17-25-13-4-3-9-19(22)20(27)26-16-8-15-24-12-6-5-11-23-14-7-10-21/h18-19,23-25H,3-17,21-22H2,1-2H3,(H,26,27)/t19-/m0/s1 |
| InChIKey | GIPISTCBAXKQKF-IBGZPJMESA-N |
| XLogP | 0.54 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.63 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|