C20H37F7N6O2 — CID 10301860
(2R)-2-amino-N-[3-[4-(3-aminopropylamino)butylamino]propyl]-6-(2,2,3,3,4,4,4-heptafluorobutanoylamino)hexanamide (PubChem CID 10301860) has the molecular formula C20H37F7N6O2 and a molecular weight of 526.54 g/mol. Its IUPAC name is (2R)-2-amino-N-[3-[4-(3-aminopropylamino)butylamino]propyl]-6-(2,2,3,3,4,4,4-heptafluorobutanoylamino)hexanamide.
| Compound Name | (2R)-2-amino-N-[3-[4-(3-aminopropylamino)butylamino]propyl]-6-(2,2,3,3,4,4,4-heptafluorobutanoylamino)hexanamide |
|---|---|
| PubChem CID | 10301860 |
| Molecular Formula | C20H37F7N6O2 |
| Molecular Weight | 526.54 g/mol |
| Exact Mass | 526.29 |
| IUPAC Name | (2R)-2-amino-N-[3-[4-(3-aminopropylamino)butylamino]propyl]-6-(2,2,3,3,4,4,4-heptafluorobutanoylamino)hexanamide |
| SMILES | NCCCNCCCCNCCCNC(=O)[C@H](N)CCCCNC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H37F7N6O2/c21-18(22,19(23,24)20(25,26)27)17(35)33-13-2-1-7-15(29)16(34)32-14-6-12-31-10-4-3-9-30-11-5-8-28/h15,30-31H,1-14,28-29H2,(H,32,34)(H,33,35)/t15-/m1/s1 |
| InChIKey | DZZUMTZUEQJLFR-OAHLLOKOSA-N |
| XLogP | 1.25 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.54 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|