C23H48N6O2 — CID 72568812
N-[5-amino-6-[3-[4-(3-aminopropylamino)butylamino]propylamino]-6-oxohexyl]cyclohexanecarboxamide (PubChem CID 72568812) has the molecular formula C23H48N6O2 and a molecular weight of 440.68 g/mol. Its IUPAC name is N-[5-amino-6-[3-[4-(3-aminopropylamino)butylamino]propylamino]-6-oxohexyl]cyclohexanecarboxamide.
| Compound Name | N-[5-amino-6-[3-[4-(3-aminopropylamino)butylamino]propylamino]-6-oxohexyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 72568812 |
| Molecular Formula | C23H48N6O2 |
| Molecular Weight | 440.68 g/mol |
| Exact Mass | 440.38 |
| IUPAC Name | N-[5-amino-6-[3-[4-(3-aminopropylamino)butylamino]propylamino]-6-oxohexyl]cyclohexanecarboxamide |
| SMILES | NCCCNCCCCNCCCNC(=O)C(N)CCCCNC(=O)C1CCCCC1 |
| InChI | InChI=1S/C23H48N6O2/c24-13-8-16-26-14-6-7-15-27-17-9-19-29-23(31)21(25)12-4-5-18-28-22(30)20-10-2-1-3-11-20/h20-21,26-27H,1-19,24-25H2,(H,28,30)(H,29,31) |
| InChIKey | KDMOAYQNJPOLRC-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.68 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|