C25H50N4O2 — CID 58260226
N-[(5S)-5-amino-15-(3-aminopropylamino)-6-oxopentadecyl]cyclohexanecarboxamide (PubChem CID 58260226) has the molecular formula C25H50N4O2 and a molecular weight of 438.70 g/mol. Its IUPAC name is N-[(5S)-5-amino-15-(3-aminopropylamino)-6-oxopentadecyl]cyclohexanecarboxamide.
| Compound Name | N-[(5S)-5-amino-15-(3-aminopropylamino)-6-oxopentadecyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 58260226 |
| Molecular Formula | C25H50N4O2 |
| Molecular Weight | 438.70 g/mol |
| Exact Mass | 438.39 |
| IUPAC Name | N-[(5S)-5-amino-15-(3-aminopropylamino)-6-oxopentadecyl]cyclohexanecarboxamide |
| SMILES | NCCCNCCCCCCCCCC(=O)[C@@H](N)CCCCNC(=O)C1CCCCC1 |
| InChI | InChI=1S/C25H50N4O2/c26-18-13-20-28-19-11-5-3-1-2-4-9-17-24(30)23(27)16-10-12-21-29-25(31)22-14-7-6-8-15-22/h22-23,28H,1-21,26-27H2,(H,29,31)/t23-/m0/s1 |
| InChIKey | NGRVYDWNHOVNHP-QHCPKHFHSA-N |
| XLogP | 3.81 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.70 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|