C22H46N4O2 — CID 58260252
N-[(5S)-5-amino-15-(3-aminopropylamino)-6-oxopentadecyl]butanamide (PubChem CID 58260252) has the molecular formula C22H46N4O2 and a molecular weight of 398.64 g/mol. Its IUPAC name is N-[(5S)-5-amino-15-(3-aminopropylamino)-6-oxopentadecyl]butanamide.
| Compound Name | N-[(5S)-5-amino-15-(3-aminopropylamino)-6-oxopentadecyl]butanamide |
|---|---|
| PubChem CID | 58260252 |
| Molecular Formula | C22H46N4O2 |
| Molecular Weight | 398.64 g/mol |
| Exact Mass | 398.36 |
| IUPAC Name | N-[(5S)-5-amino-15-(3-aminopropylamino)-6-oxopentadecyl]butanamide |
| SMILES | CCCC(=O)NCCCC[C@H](N)C(=O)CCCCCCCCCNCCCN |
| InChI | InChI=1S/C22H46N4O2/c1-2-13-22(28)26-19-11-9-14-20(24)21(27)15-8-6-4-3-5-7-10-17-25-18-12-16-23/h20,25H,2-19,23-24H2,1H3,(H,26,28)/t20-/m0/s1 |
| InChIKey | OTNYOCJKJKKAFF-FQEVSTJZSA-N |
| XLogP | 3.03 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.64 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|