C19H42N6O2 — CID 59104625
(2R)-2-amino-N-[3-[4-(3-aminopropylamino)butylamino]propyl]-5-(butanoylamino)pentanamide (PubChem CID 59104625) has the molecular formula C19H42N6O2 and a molecular weight of 386.59 g/mol. Its IUPAC name is (2R)-2-amino-N-[3-[4-(3-aminopropylamino)butylamino]propyl]-5-(butanoylamino)pentanamide.
| Compound Name | (2R)-2-amino-N-[3-[4-(3-aminopropylamino)butylamino]propyl]-5-(butanoylamino)pentanamide |
|---|---|
| PubChem CID | 59104625 |
| Molecular Formula | C19H42N6O2 |
| Molecular Weight | 386.59 g/mol |
| Exact Mass | 386.34 |
| IUPAC Name | (2R)-2-amino-N-[3-[4-(3-aminopropylamino)butylamino]propyl]-5-(butanoylamino)pentanamide |
| SMILES | CCCC(=O)NCCC[C@@H](N)C(=O)NCCCNCCCCNCCCN |
| InChI | InChI=1S/C19H42N6O2/c1-2-8-18(26)24-15-5-9-17(21)19(27)25-16-7-14-23-12-4-3-11-22-13-6-10-20/h17,22-23H,2-16,20-21H2,1H3,(H,24,26)(H,25,27)/t17-/m1/s1 |
| InChIKey | GWXVBCZMHFBJSO-QGZVFWFLSA-N |
| XLogP | -0.18 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.59 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|