C12H26N4O3 — CID 54491991
(2S)-2-amino-5-[3-(4-aminobutylamino)propylamino]-5-oxopentanoic acid (PubChem CID 54491991) has the molecular formula C12H26N4O3 and a molecular weight of 274.37 g/mol. Its IUPAC name is (2S)-2-amino-5-[3-(4-aminobutylamino)propylamino]-5-oxopentanoic acid.
| Compound Name | (2S)-2-amino-5-[3-(4-aminobutylamino)propylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 54491991 |
| Molecular Formula | C12H26N4O3 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | (2S)-2-amino-5-[3-(4-aminobutylamino)propylamino]-5-oxopentanoic acid |
| SMILES | NCCCCNCCCNC(=O)CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C12H26N4O3/c13-6-1-2-7-15-8-3-9-16-11(17)5-4-10(14)12(18)19/h10,15H,1-9,13-14H2,(H,16,17)(H,18,19)/t10-/m0/s1 |
| InChIKey | XWJLUKNQKKQMMS-JTQLQIEISA-N |
| XLogP | -0.99 |
| TPSA | 130.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|