C17H33N5O6 — CID 175384672
2-amino-5-[(4-amino-4-carboxybutanoyl)-[4-(3-aminopropylamino)butyl]amino]-5-oxopentanoic acid (PubChem CID 175384672) has the molecular formula C17H33N5O6 and a molecular weight of 403.48 g/mol. Its IUPAC name is 2-amino-5-[(4-amino-4-carboxybutanoyl)-[4-(3-aminopropylamino)butyl]amino]-5-oxopentanoic acid.
| Compound Name | 2-amino-5-[(4-amino-4-carboxybutanoyl)-[4-(3-aminopropylamino)butyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 175384672 |
| Molecular Formula | C17H33N5O6 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | 2-amino-5-[(4-amino-4-carboxybutanoyl)-[4-(3-aminopropylamino)butyl]amino]-5-oxopentanoic acid |
| SMILES | NCCCNCCCCN(C(=O)CCC(N)C(=O)O)C(=O)CCC(N)C(=O)O |
| InChI | InChI=1S/C17H33N5O6/c18-8-3-10-21-9-1-2-11-22(14(23)6-4-12(19)16(25)26)15(24)7-5-13(20)17(27)28/h12-13,21H,1-11,18-20H2,(H,25,26)(H,27,28) |
| InChIKey | ISYVXKSICWOVCU-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 202.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|