C21H44N4O5S2 — CID 158644391
2-amino-5-[[8-[(8-amino-8-oxooctyl)amino]-8-oxooctyl]amino]-5-oxopentanoic acid;sulfane (PubChem CID 158644391) has the molecular formula C21H44N4O5S2 and a molecular weight of 496.74 g/mol. Its IUPAC name is 2-amino-5-[[8-[(8-amino-8-oxooctyl)amino]-8-oxooctyl]amino]-5-oxopentanoic acid;sulfane.
| Compound Name | 2-amino-5-[[8-[(8-amino-8-oxooctyl)amino]-8-oxooctyl]amino]-5-oxopentanoic acid;sulfane |
|---|---|
| PubChem CID | 158644391 |
| Molecular Formula | C21H44N4O5S2 |
| Molecular Weight | 496.74 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | 2-amino-5-[[8-[(8-amino-8-oxooctyl)amino]-8-oxooctyl]amino]-5-oxopentanoic acid;sulfane |
| SMILES | NC(=O)CCCCCCCNC(=O)CCCCCCCNC(=O)CCC(N)C(=O)O.S.S |
| InChI | InChI=1S/C21H40N4O5.2H2S/c22-17(21(29)30)13-14-20(28)25-16-10-6-2-4-8-12-19(27)24-15-9-5-1-3-7-11-18(23)26;;/h17H,1-16,22H2,(H2,23,26)(H,24,27)(H,25,28)(H,29,30);2*1H2 |
| InChIKey | IATZMULRAJGAAP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 164.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.74 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|